C11H22O — CID 18730220
2,3,4,5,6-pentamethylcyclohexan-1-ol (PubChem CID 18730220) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethylcyclohexan-1-ol.
| Compound Name | 2,3,4,5,6-pentamethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 18730220 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 2,3,4,5,6-pentamethylcyclohexan-1-ol |
| SMILES | CC1C(C)C(C)C(O)C(C)C1C |
| InChI | InChI=1S/C11H22O/c1-6-7(2)9(4)11(12)10(5)8(6)3/h6-12H,1-5H3 |
| InChIKey | BMUJHGIQRUGLHD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |