C11H23Ir- — CID 162298825
carbanide;iridium tetrahydride;1,2,3,4,5-pentamethylcyclopentane (PubChem CID 162298825) has the molecular formula C11H23Ir- and a molecular weight of 347.52 g/mol. Its IUPAC name is carbanide;iridium tetrahydride;1,2,3,4,5-pentamethylcyclopentane.
| Compound Name | carbanide;iridium tetrahydride;1,2,3,4,5-pentamethylcyclopentane |
|---|---|
| PubChem CID | 162298825 |
| Molecular Formula | C11H23Ir- |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | carbanide;iridium tetrahydride;1,2,3,4,5-pentamethylcyclopentane |
| SMILES | CC1C(C)C(C)C(C)C1C.[CH3-].[Ir] |
| InChI | InChI=1S/C10H20.CH3.Ir/c1-6-7(2)9(4)10(5)8(6)3;;/h6-10H,1-5H3;1H3;/q;-1; |
| InChIKey | YKAUBKZPXVHFPH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|