C14H24 — CID 123787796
2,4,6,7,8-pentamethyltricyclo[3.3.1.03,9]nonane (PubChem CID 123787796) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 2,4,6,7,8-pentamethyltricyclo[3.3.1.03,9]nonane.
| Compound Name | 2,4,6,7,8-pentamethyltricyclo[3.3.1.03,9]nonane |
|---|---|
| PubChem CID | 123787796 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 2,4,6,7,8-pentamethyltricyclo[3.3.1.03,9]nonane |
| SMILES | CC1C(C)C2C(C)C3C(C)C(C1C)C23 |
| InChI | InChI=1S/C14H24/c1-6-7(2)11-9(4)13-10(5)12(8(6)3)14(11)13/h6-14H,1-5H3 |
| InChIKey | PBVQAGXHFJGYHN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |