C12H20 — CID 58241652
(7S,8R)-3,4,7,8-tetramethyltricyclo[4.2.0.02,5]octane (PubChem CID 58241652) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (7S,8R)-3,4,7,8-tetramethyltricyclo[4.2.0.02,5]octane.
| Compound Name | (7S,8R)-3,4,7,8-tetramethyltricyclo[4.2.0.02,5]octane |
|---|---|
| PubChem CID | 58241652 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (7S,8R)-3,4,7,8-tetramethyltricyclo[4.2.0.02,5]octane |
| SMILES | CC1C(C)C2C1C1C2[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C12H20/c1-5-6(2)10-9(5)11-7(3)8(4)12(10)11/h5-12H,1-4H3/t5-,6+,7?,8?,9?,10?,11?,12? |
| InChIKey | HXRJCHNITJWZIK-REWDQGBHSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |