C13H22 — CID 123396298
3-ethyl-4,7,8-trimethyltricyclo[4.2.0.02,5]octane (PubChem CID 123396298) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 3-ethyl-4,7,8-trimethyltricyclo[4.2.0.02,5]octane.
| Compound Name | 3-ethyl-4,7,8-trimethyltricyclo[4.2.0.02,5]octane |
|---|---|
| PubChem CID | 123396298 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 3-ethyl-4,7,8-trimethyltricyclo[4.2.0.02,5]octane |
| SMILES | CCC1C(C)C2C3C(C)C(C)C3C12 |
| InChI | InChI=1S/C13H22/c1-5-9-8(4)12-10-6(2)7(3)11(10)13(9)12/h6-13H,5H2,1-4H3 |
| InChIKey | KEUTVEPFQZNOCO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |