C13H26 — CID 143806596
(5R)-1-ethyl-2,3,4,5,6-pentamethylcyclohexane (PubChem CID 143806596) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is (5R)-1-ethyl-2,3,4,5,6-pentamethylcyclohexane.
| Compound Name | (5R)-1-ethyl-2,3,4,5,6-pentamethylcyclohexane |
|---|---|
| PubChem CID | 143806596 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | (5R)-1-ethyl-2,3,4,5,6-pentamethylcyclohexane |
| SMILES | CCC1C(C)C(C)C(C)[C@@H](C)C1C |
| InChI | InChI=1S/C13H26/c1-7-13-11(5)9(3)8(2)10(4)12(13)6/h8-13H,7H2,1-6H3/t8?,9-,10?,11?,12?,13?/m1/s1 |
| InChIKey | XMCLUSBTUWYOEU-HPFDTCNMSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |