About cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane
cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane (PubChem CID 59954456) has the molecular formula C7H14
and a molecular weight of 98.19 g/mol. Its IUPAC name is cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane.
Analyze cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane?
The IUPAC name of cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane (CID 59954456) is cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane.
What is the SMILES notation for cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane?
The canonical SMILES for cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane is CCC1[C@@H](C)[C@H]1C.
What is the InChIKey of cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane?
The InChIKey is VRJOYUQFEXXSBK-MEKDEQNOSA-N. The full InChI is InChI=1S/C7H14/c1-4-7-5(2)6(7)3/h5-7H,4H2,1-3H3/t5-,6+,7?.
What are the key properties of cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane?
cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane has a molecular weight of 98.19 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2R,3S)-1-ethyl-2,3-dimethylcyclopropane is sourced from PubChem (CID 59954456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).