C12H22 — CID 159924784
(3R,5R,6S)-2-ethyl-3,5,6-trimethylbicyclo[2.2.1]heptane (PubChem CID 159924784) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (3R,5R,6S)-2-ethyl-3,5,6-trimethylbicyclo[2.2.1]heptane.
| Compound Name | (3R,5R,6S)-2-ethyl-3,5,6-trimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 159924784 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (3R,5R,6S)-2-ethyl-3,5,6-trimethylbicyclo[2.2.1]heptane |
| SMILES | CCC1C2CC([C@H]1C)[C@H](C)[C@@H]2C |
| InChI | InChI=1S/C12H22/c1-5-10-9(4)11-6-12(10)8(3)7(11)2/h7-12H,5-6H2,1-4H3/t7-,8+,9+,10?,11?,12?/m1/s1 |
| InChIKey | ZTDFZGQIUJFUCA-HIMMFARQSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |