About [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine
[3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine (PubChem CID 122645180) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine.
Molecular Properties
| Compound Name | [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine |
| PubChem CID | 122645180 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine |
| SMILES | CC1C(C)C2CC1C(CN)C2CN |
| InChI | InChI=1S/C11H22N2/c1-6-7(2)9-3-8(6)10(4-12)11(9)5-13/h6-11H,3-5,12-13H2,1-2H3 |
| InChIKey | ORMYRNIGXILEOK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine?
The IUPAC name of [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine (CID 122645180) is [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine.
What is the SMILES notation for [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine?
The canonical SMILES for [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine is CC1C(C)C2CC1C(CN)C2CN.
What is the InChIKey of [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine?
The InChIKey is ORMYRNIGXILEOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-6-7(2)9-3-8(6)10(4-12)11(9)5-13/h6-11H,3-5,12-13H2,1-2H3.
What are the key properties of [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine?
[3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine has a molecular weight of 182.31 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aminomethyl)-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl]methanamine is sourced from PubChem (CID 122645180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).