C13H24 — CID 21354381
3-methyl-2,4-dipropylbicyclo[3.1.0]hexane (PubChem CID 21354381) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 3-methyl-2,4-dipropylbicyclo[3.1.0]hexane.
| Compound Name | 3-methyl-2,4-dipropylbicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 21354381 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 3-methyl-2,4-dipropylbicyclo[3.1.0]hexane |
| SMILES | CCCC1C(C)C(CCC)C2CC12 |
| InChI | InChI=1S/C13H24/c1-4-6-10-9(3)11(7-5-2)13-8-12(10)13/h9-13H,4-8H2,1-3H3 |
| InChIKey | YLZDUCJNVNUKMD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |