C11H20 — CID 58729228
(1R,4S)-2-methyl-3-propylbicyclo[2.2.1]heptane (PubChem CID 58729228) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (1R,4S)-2-methyl-3-propylbicyclo[2.2.1]heptane.
| Compound Name | (1R,4S)-2-methyl-3-propylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 58729228 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (1R,4S)-2-methyl-3-propylbicyclo[2.2.1]heptane |
| SMILES | CCCC1C(C)[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C11H20/c1-3-4-11-8(2)9-5-6-10(11)7-9/h8-11H,3-7H2,1-2H3/t8?,9-,10+,11?/m1/s1 |
| InChIKey | WLTDYZNLDKNMLM-WIFZPCQCSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |