C17H30 — CID 59917128
2,4,5,6-tetramethyl-3-propyl-1,1a,2,2a,3,4,5,5a,6,6a-decahydrocyclopropa[f]indene (PubChem CID 59917128) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 2,4,5,6-tetramethyl-3-propyl-1,1a,2,2a,3,4,5,5a,6,6a-decahydrocyclopropa[f]indene.
| Compound Name | 2,4,5,6-tetramethyl-3-propyl-1,1a,2,2a,3,4,5,5a,6,6a-decahydrocyclopropa[f]indene |
|---|---|
| PubChem CID | 59917128 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 2,4,5,6-tetramethyl-3-propyl-1,1a,2,2a,3,4,5,5a,6,6a-decahydrocyclopropa[f]indene |
| SMILES | CCCC1C(C)C(C)C2C(C)C3CC3C(C)C12 |
| InChI | InChI=1S/C17H30/c1-6-7-13-9(2)10(3)16-11(4)14-8-15(14)12(5)17(13)16/h9-17H,6-8H2,1-5H3 |
| InChIKey | ITLYGABYBULCEW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |