C24H44O2 — CID 18683566
(3,4,5,6,7-pentamethyl-8-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl) 2,2-dimethylbutanoate (PubChem CID 18683566) has the molecular formula C24H44O2 and a molecular weight of 364.61 g/mol. Its IUPAC name is (3,4,5,6,7-pentamethyl-8-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl) 2,2-dimethylbutanoate.
| Compound Name | (3,4,5,6,7-pentamethyl-8-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 18683566 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | (3,4,5,6,7-pentamethyl-8-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl) 2,2-dimethylbutanoate |
| SMILES | CCCC1C(C)C(C)C(C)C2C(C)C(C)CC(OC(=O)C(C)(C)CC)C12 |
| InChI | InChI=1S/C24H44O2/c1-10-12-19-17(6)16(5)18(7)21-15(4)14(3)13-20(22(19)21)26-23(25)24(8,9)11-2/h14-22H,10-13H2,1-9H3 |
| InChIKey | XBBFQSHNMNOEEQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |