C25H46O5 — CID 57109055
[(1S,3S,4S,4aR,7S,8S,8aR)-8-[(3R,5R)-3,5-dihydroxyheptyl]-4-hydroxy-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 57109055) has the molecular formula C25H46O5 and a molecular weight of 426.64 g/mol. Its IUPAC name is [(1S,3S,4S,4aR,7S,8S,8aR)-8-[(3R,5R)-3,5-dihydroxyheptyl]-4-hydroxy-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3S,4S,4aR,7S,8S,8aR)-8-[(3R,5R)-3,5-dihydroxyheptyl]-4-hydroxy-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 57109055 |
| Molecular Formula | C25H46O5 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | [(1S,3S,4S,4aR,7S,8S,8aR)-8-[(3R,5R)-3,5-dihydroxyheptyl]-4-hydroxy-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CC[C@@H](O)C[C@H](O)CC[C@@H]1[C@@H]2[C@@H](CC[C@@H]1C)[C@@H](O)[C@@H](C)C[C@@H]2OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C25H46O5/c1-7-17(26)14-18(27)10-12-19-15(3)9-11-20-22(19)21(13-16(4)23(20)28)30-24(29)25(5,6)8-2/h15-23,26-28H,7-14H2,1-6H3/t15-,16-,17+,18+,19-,20+,21-,22+,23-/m0/s1 |
| InChIKey | LPHGFLQTYPXVCT-IQRQQRDDSA-N |
| XLogP | 4.32 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |