C19H36 — CID 59116018
1,2,4,5,6,7-hexamethyl-3-propyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene (PubChem CID 59116018) has the molecular formula C19H36 and a molecular weight of 264.50 g/mol. Its IUPAC name is 1,2,4,5,6,7-hexamethyl-3-propyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene.
| Compound Name | 1,2,4,5,6,7-hexamethyl-3-propyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene |
|---|---|
| PubChem CID | 59116018 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | 1,2,4,5,6,7-hexamethyl-3-propyl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene |
| SMILES | CCCC1C(C)C(C)C2CC(C)C(C)C(C)C(C)C12 |
| InChI | InChI=1S/C19H36/c1-8-9-17-14(5)15(6)18-10-11(2)12(3)13(4)16(7)19(17)18/h11-19H,8-10H2,1-7H3 |
| InChIKey | CLSFOOMHAUQPGB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |