C12H22 — CID 123902108
2-butyl-3,4-dimethylbicyclo[3.1.0]hexane (PubChem CID 123902108) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is 2-butyl-3,4-dimethylbicyclo[3.1.0]hexane.
| Compound Name | 2-butyl-3,4-dimethylbicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 123902108 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 2-butyl-3,4-dimethylbicyclo[3.1.0]hexane |
| SMILES | CCCCC1C(C)C(C)C2CC12 |
| InChI | InChI=1S/C12H22/c1-4-5-6-10-8(2)9(3)11-7-12(10)11/h8-12H,4-7H2,1-3H3 |
| InChIKey | DFIQAGBALFTDFJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |