C20H34 — CID 169052624
9-ethyl-4-methyl-5-pentyltetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 169052624) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 9-ethyl-4-methyl-5-pentyltetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 9-ethyl-4-methyl-5-pentyltetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 169052624 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 9-ethyl-4-methyl-5-pentyltetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CCCCCC1C(C)C2CC1C1C3CC(CC3CC)C21 |
| InChI | InChI=1S/C20H34/c1-4-6-7-8-15-12(3)16-11-18(15)20-17-10-14(19(16)20)9-13(17)5-2/h12-20H,4-11H2,1-3H3 |
| InChIKey | IJBOOSTXIBXUFH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|