C12H26 — CID 143707793
1,2-dimethyl-3-pentylcyclopropane;ethane (PubChem CID 143707793) has the molecular formula C12H26 and a molecular weight of 170.34 g/mol. Its IUPAC name is 1,2-dimethyl-3-pentylcyclopropane;ethane.
| Compound Name | 1,2-dimethyl-3-pentylcyclopropane;ethane |
|---|---|
| PubChem CID | 143707793 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | 1,2-dimethyl-3-pentylcyclopropane;ethane |
| SMILES | CC.CCCCCC1C(C)C1C |
| InChI | InChI=1S/C10H20.C2H6/c1-4-5-6-7-10-8(2)9(10)3;1-2/h8-10H,4-7H2,1-3H3;1-2H3 |
| InChIKey | JESQZYPHRFTUEJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|