C13H26O2 — CID 59637157
3,4,6-trimethyl-5-pentyloxan-2-ol (PubChem CID 59637157) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 3,4,6-trimethyl-5-pentyloxan-2-ol.
| Compound Name | 3,4,6-trimethyl-5-pentyloxan-2-ol |
|---|---|
| PubChem CID | 59637157 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 3,4,6-trimethyl-5-pentyloxan-2-ol |
| SMILES | CCCCCC1C(C)OC(O)C(C)C1C |
| InChI | InChI=1S/C13H26O2/c1-5-6-7-8-12-9(2)10(3)13(14)15-11(12)4/h9-14H,5-8H2,1-4H3 |
| InChIKey | TVCQIWHKWNVLMI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|