C17H40O2Si3 — CID 102422602
[(1S,2S,3R)-2-hexyl-3-methylcyclopropyl]-methyl-bis(trimethylsilyloxy)silane (PubChem CID 102422602) has the molecular formula C17H40O2Si3 and a molecular weight of 360.76 g/mol. Its IUPAC name is [(1S,2S,3R)-2-hexyl-3-methylcyclopropyl]-methyl-bis(trimethylsilyloxy)silane.
| Compound Name | [(1S,2S,3R)-2-hexyl-3-methylcyclopropyl]-methyl-bis(trimethylsilyloxy)silane |
|---|---|
| PubChem CID | 102422602 |
| Molecular Formula | C17H40O2Si3 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(1S,2S,3R)-2-hexyl-3-methylcyclopropyl]-methyl-bis(trimethylsilyloxy)silane |
| SMILES | CCCCCC[C@H]1[C@@H](C)[C@@H]1[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H40O2Si3/c1-10-11-12-13-14-16-15(2)17(16)22(9,18-20(3,4)5)19-21(6,7)8/h15-17H,10-14H2,1-9H3/t15-,16+,17+/m1/s1 |
| InChIKey | PEJXRZKRBJTPRW-IKGGRYGDSA-N |
| XLogP | 6.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|