C14H28O2 — CID 163304158
2-nonylcyclopentane-1,3-diol (PubChem CID 163304158) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-nonylcyclopentane-1,3-diol.
| Compound Name | 2-nonylcyclopentane-1,3-diol |
|---|---|
| PubChem CID | 163304158 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 2-nonylcyclopentane-1,3-diol |
| SMILES | CCCCCCCCCC1C(O)CCC1O |
| InChI | InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-12-13(15)10-11-14(12)16/h12-16H,2-11H2,1H3 |
| InChIKey | ZSIQJMZPSQKABM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|