C22H38O5S2Y-2 — CID 159132948
2-methanidyl-5,6-dimethyl-3-(sulfinatomethyl)bicyclo[2.2.1]heptane;(3,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)methanesulfonic acid;yttrium (PubChem CID 159132948) has the molecular formula C22H38O5S2Y-2 and a molecular weight of 535.58 g/mol. Its IUPAC name is 2-methanidyl-5,6-dimethyl-3-(sulfinatomethyl)bicyclo[2.2.1]heptane;(3,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)methanesulfonic acid;yttrium.
| Compound Name | 2-methanidyl-5,6-dimethyl-3-(sulfinatomethyl)bicyclo[2.2.1]heptane;(3,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)methanesulfonic acid;yttrium |
|---|---|
| PubChem CID | 159132948 |
| Molecular Formula | C22H38O5S2Y-2 |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 2-methanidyl-5,6-dimethyl-3-(sulfinatomethyl)bicyclo[2.2.1]heptane;(3,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)methanesulfonic acid;yttrium |
| SMILES | CC1C(C)C2CC1C(C)C2CS(=O)(=O)O.[CH2-]C1C2CC(C(C)C2C)C1C[S-](=O)=O.[Y] |
| InChI | InChI=1S/C11H20O3S.C11H18O2S.Y/c1-6-7(2)10-4-9(6)8(3)11(10)5-15(12,13)14;1-6-7(2)10-4-9(6)8(3)11(10)5-14(12)13;/h6-11H,4-5H2,1-3H3,(H,12,13,14);6-11H,3-5H2,1-2H3;/q;-2; |
| InChIKey | NENKFORLLPMMKQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|