About 3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane
3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane (PubChem CID 123860685) has the molecular formula C17H30
and a molecular weight of 234.43 g/mol. Its IUPAC name is 3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane.
Analyze 3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane?
The IUPAC name of 3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane (CID 123860685) is 3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane.
What is the SMILES notation for 3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane?
The canonical SMILES for 3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane is CCCC(C)C1CCC2C1C1C(C)C(CC)C21.
What is the InChIKey of 3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane?
The InChIKey is OQKWJCMRUDSLHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30/c1-5-7-10(3)13-8-9-14-16-12(6-2)11(4)15(16)17(13)14/h10-17H,5-9H2,1-4H3.
What are the key properties of 3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane?
3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane has a molecular weight of 234.43 g/mol, XLogP of 4.99, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-methyl-7-pentan-2-yltricyclo[4.3.0.02,5]nonane is sourced from PubChem (CID 123860685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).