C10H22O5 — CID 143664735
6-methylcyclohexane-1,2,3,4,5-pentol;propane (PubChem CID 143664735) has the molecular formula C10H22O5 and a molecular weight of 222.28 g/mol. Its IUPAC name is 6-methylcyclohexane-1,2,3,4,5-pentol;propane.
| Compound Name | 6-methylcyclohexane-1,2,3,4,5-pentol;propane |
|---|---|
| PubChem CID | 143664735 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 6-methylcyclohexane-1,2,3,4,5-pentol;propane |
| SMILES | CC1C(O)C(O)C(O)C(O)C1O.CCC |
| InChI | InChI=1S/C7H14O5.C3H8/c1-2-3(8)5(10)7(12)6(11)4(2)9;1-3-2/h2-12H,1H3;3H2,1-2H3 |
| InChIKey | FHMOURMTNBQNOM-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |