C9H20O5 — CID 143664733
ethane;6-methylcyclohexane-1,2,3,4,5-pentol (PubChem CID 143664733) has the molecular formula C9H20O5 and a molecular weight of 208.25 g/mol. Its IUPAC name is ethane;6-methylcyclohexane-1,2,3,4,5-pentol.
| Compound Name | ethane;6-methylcyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 143664733 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | ethane;6-methylcyclohexane-1,2,3,4,5-pentol |
| SMILES | CC.CC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C7H14O5.C2H6/c1-2-3(8)5(10)7(12)6(11)4(2)9;1-2/h2-12H,1H3;1-2H3 |
| InChIKey | IYFFVXYEQBUQOR-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |