C9H20OS — CID 144965503
ethane;2,4,5-trimethylthiolan-3-ol (PubChem CID 144965503) has the molecular formula C9H20OS and a molecular weight of 176.32 g/mol. Its IUPAC name is ethane;2,4,5-trimethylthiolan-3-ol.
| Compound Name | ethane;2,4,5-trimethylthiolan-3-ol |
|---|---|
| PubChem CID | 144965503 |
| Molecular Formula | C9H20OS |
| Molecular Weight | 176.32 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | ethane;2,4,5-trimethylthiolan-3-ol |
| SMILES | CC.CC1SC(C)C(O)C1C |
| InChI | InChI=1S/C7H14OS.C2H6/c1-4-5(2)9-6(3)7(4)8;1-2/h4-8H,1-3H3;1-2H3 |
| InChIKey | FUOMLCRXHAEAPH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |