C6H9O4Rb3S — CID 144905302
2-hydroxy-6-methylthiane-3,4,5-triolate;tris(rubidium(1+)) (PubChem CID 144905302) has the molecular formula C6H9O4Rb3S and a molecular weight of 433.61 g/mol. Its IUPAC name is 2-hydroxy-6-methylthiane-3,4,5-triolate;tris(rubidium(1+)).
| Compound Name | 2-hydroxy-6-methylthiane-3,4,5-triolate;tris(rubidium(1+)) |
|---|---|
| PubChem CID | 144905302 |
| Molecular Formula | C6H9O4Rb3S |
| Molecular Weight | 433.61 g/mol |
| Exact Mass | 431.76 |
| IUPAC Name | 2-hydroxy-6-methylthiane-3,4,5-triolate;tris(rubidium(1+)) |
| SMILES | CC1SC(O)C([O-])C([O-])C1[O-].[Rb+].[Rb+].[Rb+] |
| InChI | InChI=1S/C6H9O4S.3Rb/c1-2-3(7)4(8)5(9)6(10)11-2;;;/h2-6,10H,1H3;;;/q-3;3*+1 |
| InChIKey | CBMBGUDCRJYVDK-UHFFFAOYSA-N |
| XLogP | -12.36 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.61 |
| LogP ≤ 5 | -12.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |