C6H12OS2 — CID 170710497
(4R,5S)-3,3,5-trimethyldithiolan-4-ol (PubChem CID 170710497) has the molecular formula C6H12OS2 and a molecular weight of 164.29 g/mol. Its IUPAC name is (4R,5S)-3,3,5-trimethyldithiolan-4-ol.
| Compound Name | (4R,5S)-3,3,5-trimethyldithiolan-4-ol |
|---|---|
| PubChem CID | 170710497 |
| Molecular Formula | C6H12OS2 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | (4R,5S)-3,3,5-trimethyldithiolan-4-ol |
| SMILES | C[C@@H]1SSC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C6H12OS2/c1-4-5(7)6(2,3)9-8-4/h4-5,7H,1-3H3/t4-,5+/m0/s1 |
| InChIKey | OVBJTIRWXGVCAD-CRCLSJGQSA-N |
| XLogP | 1.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|