About 5-methyl-3,3-diphenyldithiolan-4-ol
5-methyl-3,3-diphenyldithiolan-4-ol (PubChem CID 164565347) has the molecular formula C16H16OS2
and a molecular weight of 288.44 g/mol. Its IUPAC name is 5-methyl-3,3-diphenyldithiolan-4-ol.
Molecular Properties
| Compound Name | 5-methyl-3,3-diphenyldithiolan-4-ol |
| PubChem CID | 164565347 |
| Molecular Formula | C16H16OS2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-methyl-3,3-diphenyldithiolan-4-ol |
| SMILES | CC1SSC(c2ccccc2)(c2ccccc2)C1O |
| InChI | InChI=1S/C16H16OS2/c1-12-15(17)16(19-18-12,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15,17H,1H3 |
| InChIKey | HVXGJAUAIGVGGR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3,3-diphenyldithiolan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,3-diphenyldithiolan-4-ol?
The IUPAC name of 5-methyl-3,3-diphenyldithiolan-4-ol (CID 164565347) is 5-methyl-3,3-diphenyldithiolan-4-ol.
What is the SMILES notation for 5-methyl-3,3-diphenyldithiolan-4-ol?
The canonical SMILES for 5-methyl-3,3-diphenyldithiolan-4-ol is CC1SSC(c2ccccc2)(c2ccccc2)C1O.
What is the InChIKey of 5-methyl-3,3-diphenyldithiolan-4-ol?
The InChIKey is HVXGJAUAIGVGGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16OS2/c1-12-15(17)16(19-18-12,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15,17H,1H3.
What are the key properties of 5-methyl-3,3-diphenyldithiolan-4-ol?
5-methyl-3,3-diphenyldithiolan-4-ol has a molecular weight of 288.44 g/mol, XLogP of 4.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,3-diphenyldithiolan-4-ol is sourced from PubChem (CID 164565347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).