C11H12OS2 — CID 170710510
6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol (PubChem CID 170710510) has the molecular formula C11H12OS2 and a molecular weight of 224.35 g/mol. Its IUPAC name is 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol.
| Compound Name | 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol |
|---|---|
| PubChem CID | 170710510 |
| Molecular Formula | C11H12OS2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol |
| SMILES | OC1C(c2ccccc2)SSC12CC2 |
| InChI | InChI=1S/C11H12OS2/c12-10-9(8-4-2-1-3-5-8)13-14-11(10)6-7-11/h1-5,9-10,12H,6-7H2 |
| InChIKey | COHKJDSSXXBVNG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|