About 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol
6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol (PubChem CID 170710510) has the molecular formula C11H12OS2
and a molecular weight of 224.35 g/mol. Its IUPAC name is 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol.
Molecular Properties
| Compound Name | 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol |
| PubChem CID | 170710510 |
| Molecular Formula | C11H12OS2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol |
| SMILES | OC1C(c2ccccc2)SSC12CC2 |
| InChI | InChI=1S/C11H12OS2/c12-10-9(8-4-2-1-3-5-8)13-14-11(10)6-7-11/h1-5,9-10,12H,6-7H2 |
| InChIKey | COHKJDSSXXBVNG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol?
The IUPAC name of 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol (CID 170710510) is 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol.
What is the SMILES notation for 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol?
The canonical SMILES for 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol is OC1C(c2ccccc2)SSC12CC2.
What is the InChIKey of 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol?
The InChIKey is COHKJDSSXXBVNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12OS2/c12-10-9(8-4-2-1-3-5-8)13-14-11(10)6-7-11/h1-5,9-10,12H,6-7H2.
What are the key properties of 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol?
6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol has a molecular weight of 224.35 g/mol, XLogP of 3.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-4,5-dithiaspiro[2.4]heptan-7-ol is sourced from PubChem (CID 170710510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).