C14H20OS2 — CID 170710418
(4S,5S)-3,3-dimethyl-5-phenyl-4-propan-2-yloxydithiolane (PubChem CID 170710418) has the molecular formula C14H20OS2 and a molecular weight of 268.45 g/mol. Its IUPAC name is (4S,5S)-3,3-dimethyl-5-phenyl-4-propan-2-yloxydithiolane.
| Compound Name | (4S,5S)-3,3-dimethyl-5-phenyl-4-propan-2-yloxydithiolane |
|---|---|
| PubChem CID | 170710418 |
| Molecular Formula | C14H20OS2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (4S,5S)-3,3-dimethyl-5-phenyl-4-propan-2-yloxydithiolane |
| SMILES | CC(C)O[C@H]1[C@H](c2ccccc2)SSC1(C)C |
| InChI | InChI=1S/C14H20OS2/c1-10(2)15-13-12(16-17-14(13,3)4)11-8-6-5-7-9-11/h5-10,12-13H,1-4H3/t12-,13-/m0/s1 |
| InChIKey | PYBXBCQYHCUESV-STQMWFEESA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|