About 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane
4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane (PubChem CID 170710529) has the molecular formula C13H18O2S2
and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane.
Molecular Properties
| Compound Name | 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane |
| PubChem CID | 170710529 |
| Molecular Formula | C13H18O2S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane |
| SMILES | COc1cccc(C2SSC(C)(C)C2OC)c1 |
| InChI | InChI=1S/C13H18O2S2/c1-13(2)12(15-4)11(16-17-13)9-6-5-7-10(8-9)14-3/h5-8,11-12H,1-4H3 |
| InChIKey | CUFKIEQEENKWBE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane?
The IUPAC name of 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane (CID 170710529) is 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane.
What is the SMILES notation for 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane?
The canonical SMILES for 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane is COc1cccc(C2SSC(C)(C)C2OC)c1.
What is the InChIKey of 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane?
The InChIKey is CUFKIEQEENKWBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2S2/c1-13(2)12(15-4)11(16-17-13)9-6-5-7-10(8-9)14-3/h5-8,11-12H,1-4H3.
What are the key properties of 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane?
4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane has a molecular weight of 270.42 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-5-(3-methoxyphenyl)-3,3-dimethyldithiolane is sourced from PubChem (CID 170710529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).