C12H17NOS — CID 66231973
2-(3-methoxyphenyl)-4-methyl-1,3-thiazinane (PubChem CID 66231973) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-4-methyl-1,3-thiazinane.
| Compound Name | 2-(3-methoxyphenyl)-4-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 66231973 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(3-methoxyphenyl)-4-methyl-1,3-thiazinane |
| SMILES | COc1cccc(C2NC(C)CCS2)c1 |
| InChI | InChI=1S/C12H17NOS/c1-9-6-7-15-12(13-9)10-4-3-5-11(8-10)14-2/h3-5,8-9,12-13H,6-7H2,1-2H3 |
| InChIKey | YKNGDYGGGUWPAI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |