C18H21N3O2 — CID 178202191
4,6-bis(3-methoxyphenyl)-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 178202191) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 4,6-bis(3-methoxyphenyl)-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | 4,6-bis(3-methoxyphenyl)-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 178202191 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4,6-bis(3-methoxyphenyl)-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | COc1cccc(C2CC(c3cccc(OC)c3)NC(N)=N2)c1 |
| InChI | InChI=1S/C18H21N3O2/c1-22-14-7-3-5-12(9-14)16-11-17(21-18(19)20-16)13-6-4-8-15(10-13)23-2/h3-10,16-17H,11H2,1-2H3,(H3,19,20,21) |
| InChIKey | ZDTRUYAXQMCMMS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |