C19H21Cl2N3O3 — CID 178188532
6-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 178188532) has the molecular formula C19H21Cl2N3O3 and a molecular weight of 410.30 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | 6-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 178188532 |
| Molecular Formula | C19H21Cl2N3O3 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | COc1cc(C2CC(c3ccc(Cl)c(Cl)c3)NC(N)=N2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21Cl2N3O3/c1-25-16-7-11(8-17(26-2)18(16)27-3)15-9-14(23-19(22)24-15)10-4-5-12(20)13(21)6-10/h4-8,14-15H,9H2,1-3H3,(H3,22,23,24) |
| InChIKey | NPJUUAUHSSWAHX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |