C16H16FN3 — CID 178202152
6-(4-fluorophenyl)-4-phenyl-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 178202152) has the molecular formula C16H16FN3 and a molecular weight of 269.32 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-4-phenyl-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | 6-(4-fluorophenyl)-4-phenyl-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 178202152 |
| Molecular Formula | C16H16FN3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 6-(4-fluorophenyl)-4-phenyl-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | NC1=NC(c2ccccc2)CC(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C16H16FN3/c17-13-8-6-12(7-9-13)15-10-14(19-16(18)20-15)11-4-2-1-3-5-11/h1-9,14-15H,10H2,(H3,18,19,20) |
| InChIKey | ICLVPVNRCPKDRD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |