C16H16FNO — CID 124562870
(2R,4R)-2-(4-fluorophenyl)-4-methoxy-1,2,3,4-tetrahydroquinoline (PubChem CID 124562870) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is (2R,4R)-2-(4-fluorophenyl)-4-methoxy-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R,4R)-2-(4-fluorophenyl)-4-methoxy-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 124562870 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (2R,4R)-2-(4-fluorophenyl)-4-methoxy-1,2,3,4-tetrahydroquinoline |
| SMILES | CO[C@@H]1C[C@H](c2ccc(F)cc2)Nc2ccccc21 |
| InChI | InChI=1S/C16H16FNO/c1-19-16-10-15(11-6-8-12(17)9-7-11)18-14-5-3-2-4-13(14)16/h2-9,15-16,18H,10H2,1H3/t15-,16-/m1/s1 |
| InChIKey | UZDNKJKKXDCBGT-HZPDHXFCSA-N |
| XLogP | 4.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |