C25H37NSi — CID 102388736
[(2S)-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]methyl-tri(propan-2-yl)silane (PubChem CID 102388736) has the molecular formula C25H37NSi and a molecular weight of 379.66 g/mol. Its IUPAC name is [(2S)-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]methyl-tri(propan-2-yl)silane.
| Compound Name | [(2S)-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]methyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102388736 |
| Molecular Formula | C25H37NSi |
| Molecular Weight | 379.66 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | [(2S)-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]methyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](CC1C[C@@H](c2ccccc2)Nc2ccccc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H37NSi/c1-18(2)27(19(3)4,20(5)6)17-22-16-25(21-12-8-7-9-13-21)26-24-15-11-10-14-23(22)24/h7-15,18-20,22,25-26H,16-17H2,1-6H3/t22?,25-/m0/s1 |
| InChIKey | DJFNXPBGSHUYGX-TUXUZCGSSA-N |
| XLogP | 8.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.66 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|