C21H18F2N2 — CID 102430675
(2S,4S)-2,4-bis(4-fluorophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine (PubChem CID 102430675) has the molecular formula C21H18F2N2 and a molecular weight of 336.39 g/mol. Its IUPAC name is (2S,4S)-2,4-bis(4-fluorophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine.
| Compound Name | (2S,4S)-2,4-bis(4-fluorophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 102430675 |
| Molecular Formula | C21H18F2N2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (2S,4S)-2,4-bis(4-fluorophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
| SMILES | Fc1ccc([C@@H]2C[C@@H](c3ccc(F)cc3)Nc3ccccc3N2)cc1 |
| InChI | InChI=1S/C21H18F2N2/c22-16-9-5-14(6-10-16)20-13-21(15-7-11-17(23)12-8-15)25-19-4-2-1-3-18(19)24-20/h1-12,20-21,24-25H,13H2/t20-,21-/m0/s1 |
| InChIKey | HLCBWIXRQGEVQX-SFTDATJTSA-N |
| XLogP | 5.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|