C14H13FN2 — CID 171063111
(2S)-2-(4-fluorophenyl)-1,2,3,4-tetrahydroquinoxaline (PubChem CID 171063111) has the molecular formula C14H13FN2 and a molecular weight of 228.27 g/mol. Its IUPAC name is (2S)-2-(4-fluorophenyl)-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | (2S)-2-(4-fluorophenyl)-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 171063111 |
| Molecular Formula | C14H13FN2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (2S)-2-(4-fluorophenyl)-1,2,3,4-tetrahydroquinoxaline |
| SMILES | Fc1ccc([C@H]2CNc3ccccc3N2)cc1 |
| InChI | InChI=1S/C14H13FN2/c15-11-7-5-10(6-8-11)14-9-16-12-3-1-2-4-13(12)17-14/h1-8,14,16-17H,9H2/t14-/m1/s1 |
| InChIKey | LAJCDBLVSPUSQR-CQSZACIVSA-N |
| XLogP | 3.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|