C14H13ClN2 — CID 113459426
5-chloro-2-phenyl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 113459426) has the molecular formula C14H13ClN2 and a molecular weight of 244.73 g/mol. Its IUPAC name is 5-chloro-2-phenyl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 5-chloro-2-phenyl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 113459426 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-chloro-2-phenyl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | Clc1cccc2c1NCC(c1ccccc1)N2 |
| InChI | InChI=1S/C14H13ClN2/c15-11-7-4-8-12-14(11)16-9-13(17-12)10-5-2-1-3-6-10/h1-8,13,16-17H,9H2 |
| InChIKey | RRZALVITDKTYKY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |