C15H15ClN2 — CID 104839707
8-chloro-3-methyl-3-phenyl-2,4-dihydro-1H-quinoxaline (PubChem CID 104839707) has the molecular formula C15H15ClN2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 8-chloro-3-methyl-3-phenyl-2,4-dihydro-1H-quinoxaline.
| Compound Name | 8-chloro-3-methyl-3-phenyl-2,4-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 104839707 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 8-chloro-3-methyl-3-phenyl-2,4-dihydro-1H-quinoxaline |
| SMILES | CC1(c2ccccc2)CNc2c(Cl)cccc2N1 |
| InChI | InChI=1S/C15H15ClN2/c1-15(11-6-3-2-4-7-11)10-17-14-12(16)8-5-9-13(14)18-15/h2-9,17-18H,10H2,1H3 |
| InChIKey | UZQFKQJGSSRETB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |