About 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline
2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline (PubChem CID 103965038) has the molecular formula C18H17N3
and a molecular weight of 275.36 g/mol. Its IUPAC name is 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline.
Molecular Properties
| Compound Name | 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline |
| PubChem CID | 103965038 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline |
| SMILES | CC1(c2ccccc2)CNc2cnc3ccccc3c2N1 |
| InChI | InChI=1S/C18H17N3/c1-18(13-7-3-2-4-8-13)12-20-16-11-19-15-10-6-5-9-14(15)17(16)21-18/h2-11,20-21H,12H2,1H3 |
| InChIKey | FPMOYIQRZMVYTA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline?
The IUPAC name of 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline (CID 103965038) is 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline.
What is the SMILES notation for 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline?
The canonical SMILES for 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline is CC1(c2ccccc2)CNc2cnc3ccccc3c2N1.
What is the InChIKey of 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline?
The InChIKey is FPMOYIQRZMVYTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3/c1-18(13-7-3-2-4-8-13)12-20-16-11-19-15-10-6-5-9-14(15)17(16)21-18/h2-11,20-21H,12H2,1H3.
What are the key properties of 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline?
2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline has a molecular weight of 275.36 g/mol, XLogP of 3.99, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline is sourced from PubChem (CID 103965038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).