C18H17N3 — CID 103965038
2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline (PubChem CID 103965038) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline.
| Compound Name | 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline |
|---|---|
| PubChem CID | 103965038 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-methyl-2-phenyl-3,4-dihydro-1H-pyrazino[2,3-c]quinoline |
| SMILES | CC1(c2ccccc2)CNc2cnc3ccccc3c2N1 |
| InChI | InChI=1S/C18H17N3/c1-18(13-7-3-2-4-8-13)12-20-16-11-19-15-10-6-5-9-14(15)17(16)21-18/h2-11,20-21H,12H2,1H3 |
| InChIKey | FPMOYIQRZMVYTA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |