C18H15N — CID 164705506
11,11-dimethylindeno[1,2-c]quinoline (PubChem CID 164705506) has the molecular formula C18H15N and a molecular weight of 245.33 g/mol. Its IUPAC name is 11,11-dimethylindeno[1,2-c]quinoline.
| Compound Name | 11,11-dimethylindeno[1,2-c]quinoline |
|---|---|
| PubChem CID | 164705506 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 11,11-dimethylindeno[1,2-c]quinoline |
| SMILES | CC1(C)c2ccccc2-c2cnc3ccccc3c21 |
| InChI | InChI=1S/C18H15N/c1-18(2)15-9-5-3-7-12(15)14-11-19-16-10-6-4-8-13(16)17(14)18/h3-11H,1-2H3 |
| InChIKey | PDHRHTQIBHBNGJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |