About 9,9-dimethylfluorene;ethane;quinoline
9,9-dimethylfluorene;ethane;quinoline (PubChem CID 159714824) has the molecular formula C26H27N
and a molecular weight of 353.51 g/mol. Its IUPAC name is 9,9-dimethylfluorene;ethane;quinoline.
Molecular Properties
| Compound Name | 9,9-dimethylfluorene;ethane;quinoline |
| PubChem CID | 159714824 |
| Molecular Formula | C26H27N |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 9,9-dimethylfluorene;ethane;quinoline |
| SMILES | CC.CC1(C)c2ccccc2-c2ccccc21.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C15H14.C9H7N.C2H6/c1-15(2)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-2-6-9-8(4-1)5-3-7-10-9;1-2/h3-10H,1-2H3;1-7H;1-2H3 |
| InChIKey | MZHIKZFCYFHLOD-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9,9-dimethylfluorene;ethane;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethylfluorene;ethane;quinoline?
The IUPAC name of 9,9-dimethylfluorene;ethane;quinoline (CID 159714824) is 9,9-dimethylfluorene;ethane;quinoline.
What is the SMILES notation for 9,9-dimethylfluorene;ethane;quinoline?
The canonical SMILES for 9,9-dimethylfluorene;ethane;quinoline is CC.CC1(C)c2ccccc2-c2ccccc21.c1ccc2ncccc2c1.
What is the InChIKey of 9,9-dimethylfluorene;ethane;quinoline?
The InChIKey is MZHIKZFCYFHLOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14.C9H7N.C2H6/c1-15(2)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-2-6-9-8(4-1)5-3-7-10-9;1-2/h3-10H,1-2H3;1-7H;1-2H3.
What are the key properties of 9,9-dimethylfluorene;ethane;quinoline?
9,9-dimethylfluorene;ethane;quinoline has a molecular weight of 353.51 g/mol, XLogP of 7.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethylfluorene;ethane;quinoline is sourced from PubChem (CID 159714824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).