About prop-1-ene;quinoline
prop-1-ene;quinoline (PubChem CID 159640565) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is prop-1-ene;quinoline.
Molecular Properties
| Compound Name | prop-1-ene;quinoline |
| PubChem CID | 159640565 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | prop-1-ene;quinoline |
| SMILES | C=CC.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C3H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-2/h1-7H;3H,1H2,2H3 |
| InChIKey | MQHMFJHSTBOZIK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-1-ene;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-ene;quinoline?
The IUPAC name of prop-1-ene;quinoline (CID 159640565) is prop-1-ene;quinoline.
What is the SMILES notation for prop-1-ene;quinoline?
The canonical SMILES for prop-1-ene;quinoline is C=CC.c1ccc2ncccc2c1.
What is the InChIKey of prop-1-ene;quinoline?
The InChIKey is MQHMFJHSTBOZIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C3H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-2/h1-7H;3H,1H2,2H3.
What are the key properties of prop-1-ene;quinoline?
prop-1-ene;quinoline has a molecular weight of 171.24 g/mol, XLogP of 3.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-ene;quinoline is sourced from PubChem (CID 159640565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).