C16H21N3 — CID 103965077
3,3-diethyl-1,2,4,5-tetrahydro-[1,4]diazepino[2,3-c]quinoline (PubChem CID 103965077) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 3,3-diethyl-1,2,4,5-tetrahydro-[1,4]diazepino[2,3-c]quinoline.
| Compound Name | 3,3-diethyl-1,2,4,5-tetrahydro-[1,4]diazepino[2,3-c]quinoline |
|---|---|
| PubChem CID | 103965077 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 3,3-diethyl-1,2,4,5-tetrahydro-[1,4]diazepino[2,3-c]quinoline |
| SMILES | CCC1(CC)CNc2cnc3ccccc3c2NC1 |
| InChI | InChI=1S/C16H21N3/c1-3-16(4-2)10-18-14-9-17-13-8-6-5-7-12(13)15(14)19-11-16/h5-9,18-19H,3-4,10-11H2,1-2H3 |
| InChIKey | ZIHCRJFPOKXXNN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |