C14H15N3O — CID 103964979
2-ethyl-2-methyl-1,4-dihydropyrazino[2,3-c]quinolin-3-one (PubChem CID 103964979) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-ethyl-2-methyl-1,4-dihydropyrazino[2,3-c]quinolin-3-one.
| Compound Name | 2-ethyl-2-methyl-1,4-dihydropyrazino[2,3-c]quinolin-3-one |
|---|---|
| PubChem CID | 103964979 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-ethyl-2-methyl-1,4-dihydropyrazino[2,3-c]quinolin-3-one |
| SMILES | CCC1(C)Nc2c(cnc3ccccc23)NC1=O |
| InChI | InChI=1S/C14H15N3O/c1-3-14(2)13(18)16-11-8-15-10-7-5-4-6-9(10)12(11)17-14/h4-8,17H,3H2,1-2H3,(H,16,18) |
| InChIKey | LHVIFKITECGPDN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |