C12H10N2O2 — CID 141425510
2-methyl-4H-[1,4]oxazino[3,2-c]quinolin-3-one (PubChem CID 141425510) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-methyl-4H-[1,4]oxazino[3,2-c]quinolin-3-one.
| Compound Name | 2-methyl-4H-[1,4]oxazino[3,2-c]quinolin-3-one |
|---|---|
| PubChem CID | 141425510 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-methyl-4H-[1,4]oxazino[3,2-c]quinolin-3-one |
| SMILES | CC1Oc2c(cnc3ccccc23)NC1=O |
| InChI | InChI=1S/C12H10N2O2/c1-7-12(15)14-10-6-13-9-5-3-2-4-8(9)11(10)16-7/h2-7H,1H3,(H,14,15) |
| InChIKey | GAEHQWFZTGNCHW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |