C13H15N3 — CID 103965017
2-ethyl-1,2,3,4-tetrahydropyrazino[2,3-c]quinoline (PubChem CID 103965017) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-ethyl-1,2,3,4-tetrahydropyrazino[2,3-c]quinoline.
| Compound Name | 2-ethyl-1,2,3,4-tetrahydropyrazino[2,3-c]quinoline |
|---|---|
| PubChem CID | 103965017 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-ethyl-1,2,3,4-tetrahydropyrazino[2,3-c]quinoline |
| SMILES | CCC1CNc2cnc3ccccc3c2N1 |
| InChI | InChI=1S/C13H15N3/c1-2-9-7-14-12-8-15-11-6-4-3-5-10(11)13(12)16-9/h3-6,8-9,14,16H,2,7H2,1H3 |
| InChIKey | IQLBGAIIPLBNTG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |